3-ethynylnon-1-yn-4-ol;molecular hydrogen

C11H26O — CID 162219513

IUPAC3-ethynylnon-1-yn-4-ol;molecular hydrogen
SMILESC#CC(C#C)C(O)CCCCC.[H][H].[H][H].[H][H].[H][H].[H][H]
InChIInChI=1S/C11H16O.5H2/c1-4-7-8-9-11(12)10(5-2)6-3;;;;;/h2-3,10-12H,4,7-9H2,1H3;5*1H
InChIKeyZTXVDBZOUBQKDO-UHFFFAOYSA-N
MW174.33 g/mol
LogP3.04
Rot. Bonds5

About 3-ethynylnon-1-yn-4-ol;molecular hydrogen

3-ethynylnon-1-yn-4-ol;molecular hydrogen (PubChem CID 162219513) has the molecular formula C11H26O and a molecular weight of 174.33 g/mol. Its IUPAC name is 3-ethynylnon-1-yn-4-ol;molecular hydrogen.

Molecular Properties

Compound Name3-ethynylnon-1-yn-4-ol;molecular hydrogen
PubChem CID162219513
Molecular FormulaC11H26O
Molecular Weight174.33 g/mol
Exact Mass174.20
IUPAC Name3-ethynylnon-1-yn-4-ol;molecular hydrogen
SMILESC#CC(C#C)C(O)CCCCC.[H][H].[H][H].[H][H].[H][H].[H][H]
InChIInChI=1S/C11H16O.5H2/c1-4-7-8-9-11(12)10(5-2)6-3;;;;;/h2-3,10-12H,4,7-9H2,1H3;5*1H
InChIKeyZTXVDBZOUBQKDO-UHFFFAOYSA-N
XLogP3.04
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.33
LogP ≤ 53.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 3-ethynylnon-1-yn-4-ol;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethynylnon-1-yn-4-ol;molecular hydrogen?
The IUPAC name of 3-ethynylnon-1-yn-4-ol;molecular hydrogen (CID 162219513) is 3-ethynylnon-1-yn-4-ol;molecular hydrogen.
What is the SMILES notation for 3-ethynylnon-1-yn-4-ol;molecular hydrogen?
The canonical SMILES for 3-ethynylnon-1-yn-4-ol;molecular hydrogen is C#CC(C#C)C(O)CCCCC.[H][H].[H][H].[H][H].[H][H].[H][H].
What is the InChIKey of 3-ethynylnon-1-yn-4-ol;molecular hydrogen?
The InChIKey is ZTXVDBZOUBQKDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.5H2/c1-4-7-8-9-11(12)10(5-2)6-3;;;;;/h2-3,10-12H,4,7-9H2,1H3;5*1H.
What are the key properties of 3-ethynylnon-1-yn-4-ol;molecular hydrogen?
3-ethynylnon-1-yn-4-ol;molecular hydrogen has a molecular weight of 174.33 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynylnon-1-yn-4-ol;molecular hydrogen is sourced from PubChem (CID 162219513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).