About 3-ethynylnon-1-yn-4-ol;molecular hydrogen
3-ethynylnon-1-yn-4-ol;molecular hydrogen (PubChem CID 162219513) has the molecular formula C11H26O
and a molecular weight of 174.33 g/mol. Its IUPAC name is 3-ethynylnon-1-yn-4-ol;molecular hydrogen.
Molecular Properties
| Compound Name | 3-ethynylnon-1-yn-4-ol;molecular hydrogen |
| PubChem CID | 162219513 |
| Molecular Formula | C11H26O |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.20 |
| IUPAC Name | 3-ethynylnon-1-yn-4-ol;molecular hydrogen |
| SMILES | C#CC(C#C)C(O)CCCCC.[H][H].[H][H].[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C11H16O.5H2/c1-4-7-8-9-11(12)10(5-2)6-3;;;;;/h2-3,10-12H,4,7-9H2,1H3;5*1H |
| InChIKey | ZTXVDBZOUBQKDO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynylnon-1-yn-4-ol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynylnon-1-yn-4-ol;molecular hydrogen?
The IUPAC name of 3-ethynylnon-1-yn-4-ol;molecular hydrogen (CID 162219513) is 3-ethynylnon-1-yn-4-ol;molecular hydrogen.
What is the SMILES notation for 3-ethynylnon-1-yn-4-ol;molecular hydrogen?
The canonical SMILES for 3-ethynylnon-1-yn-4-ol;molecular hydrogen is C#CC(C#C)C(O)CCCCC.[H][H].[H][H].[H][H].[H][H].[H][H].
What is the InChIKey of 3-ethynylnon-1-yn-4-ol;molecular hydrogen?
The InChIKey is ZTXVDBZOUBQKDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.5H2/c1-4-7-8-9-11(12)10(5-2)6-3;;;;;/h2-3,10-12H,4,7-9H2,1H3;5*1H.
What are the key properties of 3-ethynylnon-1-yn-4-ol;molecular hydrogen?
3-ethynylnon-1-yn-4-ol;molecular hydrogen has a molecular weight of 174.33 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynylnon-1-yn-4-ol;molecular hydrogen is sourced from PubChem (CID 162219513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).