About 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole
2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole (PubChem CID 87372140) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole |
| PubChem CID | 87372140 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole |
| SMILES | [O-][N+]1(C2=NCCS2)CCC1 |
| InChI | InChI=1S/C6H10N2OS/c9-8(3-1-4-8)6-7-2-5-10-6/h1-5H2 |
| InChIKey | VNVKAGJSVBXGGP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole (CID 87372140) is 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole is [O-][N+]1(C2=NCCS2)CCC1.
What is the InChIKey of 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole?
The InChIKey is VNVKAGJSVBXGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS/c9-8(3-1-4-8)6-7-2-5-10-6/h1-5H2.
What are the key properties of 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole?
2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole has a molecular weight of 158.23 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-oxidoazetidin-1-ium-1-yl)-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 87372140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).