C9H15F3N2O3 — CID 87372204
amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 87372204) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 87372204 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | CCCC[C@](C)(NC(=O)C(F)(F)F)C(=O)ON |
| InChI | InChI=1S/C9H15F3N2O3/c1-3-4-5-8(2,7(16)17-13)14-6(15)9(10,11)12/h3-5,13H2,1-2H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | IOHIJOPKHWKXGX-QMMMGPOBSA-N |
| XLogP | 1.03 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|