amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate

C9H15F3N2O3 — CID 87372204

IUPACamino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate
SMILESCCCC[C@](C)(NC(=O)C(F)(F)F)C(=O)ON
InChIInChI=1S/C9H15F3N2O3/c1-3-4-5-8(2,7(16)17-13)14-6(15)9(10,11)12/h3-5,13H2,1-2H3,(H,14,15)/t8-/m0/s1
InChIKeyIOHIJOPKHWKXGX-QMMMGPOBSA-N
MW256.22 g/mol
LogP1.03
Rot. Bonds5

About amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate

amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 87372204) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.

Molecular Properties

Compound Nameamino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate
PubChem CID87372204
Molecular FormulaC9H15F3N2O3
Molecular Weight256.22 g/mol
Exact Mass256.10
IUPAC Nameamino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate
SMILESCCCC[C@](C)(NC(=O)C(F)(F)F)C(=O)ON
InChIInChI=1S/C9H15F3N2O3/c1-3-4-5-8(2,7(16)17-13)14-6(15)9(10,11)12/h3-5,13H2,1-2H3,(H,14,15)/t8-/m0/s1
InChIKeyIOHIJOPKHWKXGX-QMMMGPOBSA-N
XLogP1.03
TPSA81.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.22
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The IUPAC name of amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (CID 87372204) is amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.
What is the SMILES notation for amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The canonical SMILES for amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate is CCCC[C@](C)(NC(=O)C(F)(F)F)C(=O)ON.
What is the InChIKey of amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The InChIKey is IOHIJOPKHWKXGX-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c1-3-4-5-8(2,7(16)17-13)14-6(15)9(10,11)12/h3-5,13H2,1-2H3,(H,14,15)/t8-/m0/s1.
What are the key properties of amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate has a molecular weight of 256.22 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino (2S)-2-methyl-2-[(2,2,2-trifluoroacetyl)amino]hexanoate is sourced from PubChem (CID 87372204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).