About azane;5-chloropentan-1-amine;2-methylheptadecane
azane;5-chloropentan-1-amine;2-methylheptadecane (PubChem CID 87375688) has the molecular formula C23H53ClN2
and a molecular weight of 393.14 g/mol. Its IUPAC name is azane;5-chloropentan-1-amine;2-methylheptadecane.
Molecular Properties
| Compound Name | azane;5-chloropentan-1-amine;2-methylheptadecane |
| PubChem CID | 87375688 |
| Molecular Formula | C23H53ClN2 |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 392.39 |
| IUPAC Name | azane;5-chloropentan-1-amine;2-methylheptadecane |
| SMILES | CCCCCCCCCCCCCCCC(C)C.N.NCCCCCCl |
| InChI | InChI=1S/C18H38.C5H12ClN.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)3;6-4-2-1-3-5-7;/h18H,4-17H2,1-3H3;1-5,7H2;1H3 |
| InChIKey | QOUZLBOBNXBVDE-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;5-chloropentan-1-amine;2-methylheptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-chloropentan-1-amine;2-methylheptadecane?
The IUPAC name of azane;5-chloropentan-1-amine;2-methylheptadecane (CID 87375688) is azane;5-chloropentan-1-amine;2-methylheptadecane.
What is the SMILES notation for azane;5-chloropentan-1-amine;2-methylheptadecane?
The canonical SMILES for azane;5-chloropentan-1-amine;2-methylheptadecane is CCCCCCCCCCCCCCCC(C)C.N.NCCCCCCl.
What is the InChIKey of azane;5-chloropentan-1-amine;2-methylheptadecane?
The InChIKey is QOUZLBOBNXBVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38.C5H12ClN.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)3;6-4-2-1-3-5-7;/h18H,4-17H2,1-3H3;1-5,7H2;1H3.
What are the key properties of azane;5-chloropentan-1-amine;2-methylheptadecane?
azane;5-chloropentan-1-amine;2-methylheptadecane has a molecular weight of 393.14 g/mol, XLogP of 8.64, 18 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-chloropentan-1-amine;2-methylheptadecane is sourced from PubChem (CID 87375688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).