C22H25N3O4 — CID 87378577
3-[4-[4-(2,4-dimethylphenyl)-4-oxidopiperazin-4-ium-1-carbonyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 87378577) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[4-[4-(2,4-dimethylphenyl)-4-oxidopiperazin-4-ium-1-carbonyl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-[4-(2,4-dimethylphenyl)-4-oxidopiperazin-4-ium-1-carbonyl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87378577 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-[4-[4-(2,4-dimethylphenyl)-4-oxidopiperazin-4-ium-1-carbonyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc([N+]2([O-])CCN(C(=O)c3ccc(N4CCOC4=O)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-16-3-8-20(17(2)15-16)25(28)12-9-23(10-13-25)21(26)18-4-6-19(7-5-18)24-11-14-29-22(24)27/h3-8,15H,9-14H2,1-2H3 |
| InChIKey | BGGGEKXJLBCMFM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|