C19H13Cl7N4O3 — CID 87379793
N-(3,4-dichlorophenyl)propanamide;1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 87379793) has the molecular formula C19H13Cl7N4O3 and a molecular weight of 593.51 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)propanamide;1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid.
| Compound Name | N-(3,4-dichlorophenyl)propanamide;1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 87379793 |
| Molecular Formula | C19H13Cl7N4O3 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 589.88 |
| IUPAC Name | N-(3,4-dichlorophenyl)propanamide;1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | CCC(=O)Nc1ccc(Cl)c(Cl)c1.O=C(O)c1nc(C(Cl)(Cl)Cl)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H4Cl5N3O2.C9H9Cl2NO/c11-4-1-2-6(5(12)3-4)18-9(10(13,14)15)16-7(17-18)8(19)20;1-2-9(13)12-6-3-4-7(10)8(11)5-6/h1-3H,(H,19,20);3-5H,2H2,1H3,(H,12,13) |
| InChIKey | BUBQUAAEWVQFMB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|