C23H24FN7O3 — CID 87382935
4-N-[2-(2-fluoroethoxy)ethyl]-4-N,1-dimethyl-5-N-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)pyrazole-4,5-dicarboxamide (PubChem CID 87382935) has the molecular formula C23H24FN7O3 and a molecular weight of 465.49 g/mol. Its IUPAC name is 4-N-[2-(2-fluoroethoxy)ethyl]-4-N,1-dimethyl-5-N-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)pyrazole-4,5-dicarboxamide.
| Compound Name | 4-N-[2-(2-fluoroethoxy)ethyl]-4-N,1-dimethyl-5-N-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)pyrazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 87382935 |
| Molecular Formula | C23H24FN7O3 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-N-[2-(2-fluoroethoxy)ethyl]-4-N,1-dimethyl-5-N-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)pyrazole-4,5-dicarboxamide |
| SMILES | CN(CCOCCF)C(=O)c1cnn(C)c1C(=O)Nc1ccn2cc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C23H24FN7O3/c1-29(11-13-34-12-9-24)22(33)17-14-25-30(2)20(17)21(32)27-19-8-10-31-15-18(26-23(31)28-19)16-6-4-3-5-7-16/h3-8,10,14-15H,9,11-13H2,1-2H3,(H,26,27,28,32) |
| InChIKey | WTYVTNHXVLYMDN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|