C29H46N2O3 — CID 87384147
tert-butyl N-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]carbamate (PubChem CID 87384147) has the molecular formula C29H46N2O3 and a molecular weight of 470.70 g/mol. Its IUPAC name is tert-butyl N-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 87384147 |
| Molecular Formula | C29H46N2O3 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.35 |
| IUPAC Name | tert-butyl N-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]carbamate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H46N2O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27(32)30-25-26-31-28(33)34-29(2,3)4/h6-7,9-10,12-13,15-16,18-19,21-22H,5,8,11,14,17,20,23-26H2,1-4H3,(H,30,32)(H,31,33) |
| InChIKey | QRTQQQCXSWDEFN-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|