C18H31NO3 — CID 87384657
(9Z,12Z)-18-amino-18-oxooctadeca-9,12-dienoic acid (PubChem CID 87384657) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is (9Z,12Z)-18-amino-18-oxooctadeca-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-18-amino-18-oxooctadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 87384657 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (9Z,12Z)-18-amino-18-oxooctadeca-9,12-dienoic acid |
| SMILES | NC(=O)CCCC/C=C\C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H31NO3/c19-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22/h1-2,5,7H,3-4,6,8-16H2,(H2,19,20)(H,21,22)/b2-1-,7-5- |
| InChIKey | SYLYJRGQBJDGAT-PQZOIKATSA-N |
| XLogP | 4.35 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|