C42H28BF24N — CID 87384959
(2,3-diethylphenyl)azanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 87384959) has the molecular formula C42H28BF24N and a molecular weight of 1013.46 g/mol. Its IUPAC name is (2,3-diethylphenyl)azanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | (2,3-diethylphenyl)azanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 87384959 |
| Molecular Formula | C42H28BF24N |
| Molecular Weight | 1013.46 g/mol |
| Exact Mass | 1013.19 |
| IUPAC Name | (2,3-diethylphenyl)azanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | CCc1cccc([NH3+])c1CC.FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H12BF24.C10H15N/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-3-8-6-5-7-10(11)9(8)4-2/h1-12H;5-7H,3-4,11H2,1-2H3/q-1;/p+1 |
| InChIKey | ZICPFENRWJSVAJ-UHFFFAOYSA-O |
| XLogP | 12.90 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.46 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|