C10H24NO5P — CID 87385300
[2-[2-(2-aminoethoxy)ethoxy]-2-ethylbutyl]phosphonic acid (PubChem CID 87385300) has the molecular formula C10H24NO5P and a molecular weight of 269.28 g/mol. Its IUPAC name is [2-[2-(2-aminoethoxy)ethoxy]-2-ethylbutyl]phosphonic acid.
| Compound Name | [2-[2-(2-aminoethoxy)ethoxy]-2-ethylbutyl]phosphonic acid |
|---|---|
| PubChem CID | 87385300 |
| Molecular Formula | C10H24NO5P |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [2-[2-(2-aminoethoxy)ethoxy]-2-ethylbutyl]phosphonic acid |
| SMILES | CCC(CC)(CP(=O)(O)O)OCCOCCN |
| InChI | InChI=1S/C10H24NO5P/c1-3-10(4-2,9-17(12,13)14)16-8-7-15-6-5-11/h3-9,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | TZYBWKIJZJVXIM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|