C27H29F4N3O6S — CID 87388447
(2R)-4-acetyl-N-[(4-propan-2-ylphenyl)methyl]-1-[[6-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1,4-dioxin-2-yl]sulfonyl]piperazine-2-carboxamide (PubChem CID 87388447) has the molecular formula C27H29F4N3O6S and a molecular weight of 599.60 g/mol. Its IUPAC name is (2R)-4-acetyl-N-[(4-propan-2-ylphenyl)methyl]-1-[[6-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1,4-dioxin-2-yl]sulfonyl]piperazine-2-carboxamide.
| Compound Name | (2R)-4-acetyl-N-[(4-propan-2-ylphenyl)methyl]-1-[[6-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1,4-dioxin-2-yl]sulfonyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 87388447 |
| Molecular Formula | C27H29F4N3O6S |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | (2R)-4-acetyl-N-[(4-propan-2-ylphenyl)methyl]-1-[[6-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1,4-dioxin-2-yl]sulfonyl]piperazine-2-carboxamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)C2=COC=C(C3=CC=CC(F)(F)C3(F)F)O2)[C@@H](C(=O)NCc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C27H29F4N3O6S/c1-17(2)20-8-6-19(7-9-20)13-32-25(36)22-14-33(18(3)35)11-12-34(22)41(37,38)24-16-39-15-23(40-24)21-5-4-10-26(28,29)27(21,30)31/h4-10,15-17,22H,11-14H2,1-3H3,(H,32,36)/t22-/m1/s1 |
| InChIKey | PVCKCDNOOXLWAK-JOCHJYFZSA-N |
| XLogP | 3.74 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|