3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid

C5H6N2O4 — CID 87389629

IUPAC3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid
SMILESCN1C(=O)CN(C(=O)O)C1=O
InChIInChI=1S/C5H6N2O4/c1-6-3(8)2-7(4(6)9)5(10)11/h2H2,1H3,(H,10,11)
InChIKeyDAMOAMINTXSHDZ-UHFFFAOYSA-N
MW158.11 g/mol
LogP-0.44
Rot. Bonds

About 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid

3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid (PubChem CID 87389629) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid.

Molecular Properties

Compound Name3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid
PubChem CID87389629
Molecular FormulaC5H6N2O4
Molecular Weight158.11 g/mol
Exact Mass158.03
IUPAC Name3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid
SMILESCN1C(=O)CN(C(=O)O)C1=O
InChIInChI=1S/C5H6N2O4/c1-6-3(8)2-7(4(6)9)5(10)11/h2H2,1H3,(H,10,11)
InChIKeyDAMOAMINTXSHDZ-UHFFFAOYSA-N
XLogP-0.44
TPSA77.92 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.11
LogP ≤ 5-0.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydantoin', 'substructure': 'N/A'}

Analyze 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid?
The IUPAC name of 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid (CID 87389629) is 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid.
What is the SMILES notation for 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid?
The canonical SMILES for 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid is CN1C(=O)CN(C(=O)O)C1=O.
What is the InChIKey of 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid?
The InChIKey is DAMOAMINTXSHDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O4/c1-6-3(8)2-7(4(6)9)5(10)11/h2H2,1H3,(H,10,11).
What are the key properties of 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid?
3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid has a molecular weight of 158.11 g/mol, XLogP of -0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid is sourced from PubChem (CID 87389629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).