C5H6N2O4 — CID 87389629
3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid (PubChem CID 87389629) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid.
| Compound Name | 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87389629 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 3-methyl-2,4-dioxoimidazolidine-1-carboxylic acid |
| SMILES | CN1C(=O)CN(C(=O)O)C1=O |
| InChI | InChI=1S/C5H6N2O4/c1-6-3(8)2-7(4(6)9)5(10)11/h2H2,1H3,(H,10,11) |
| InChIKey | DAMOAMINTXSHDZ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|