C6H6N2O5 — CID 15096139
2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetic acid (PubChem CID 15096139) has the molecular formula C6H6N2O5 and a molecular weight of 186.12 g/mol. Its IUPAC name is 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetic acid.
| Compound Name | 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetic acid |
|---|---|
| PubChem CID | 15096139 |
| Molecular Formula | C6H6N2O5 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetic acid |
| SMILES | CN1C(=O)C(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C6H6N2O5/c1-7-4(11)5(12)8(6(7)13)2-3(9)10/h2H2,1H3,(H,9,10) |
| InChIKey | DBEMFGLKJCRBRS-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|