C47H51O6P3 — CID 87392310
[2-[bis(4-methoxyphenyl)-phosphanylmethyl]-1,1,3,3-tetrakis(4-methoxyphenyl)-2-methyl-3-phosphanylpropyl]phosphane (PubChem CID 87392310) has the molecular formula C47H51O6P3 and a molecular weight of 804.84 g/mol. Its IUPAC name is [2-[bis(4-methoxyphenyl)-phosphanylmethyl]-1,1,3,3-tetrakis(4-methoxyphenyl)-2-methyl-3-phosphanylpropyl]phosphane.
| Compound Name | [2-[bis(4-methoxyphenyl)-phosphanylmethyl]-1,1,3,3-tetrakis(4-methoxyphenyl)-2-methyl-3-phosphanylpropyl]phosphane |
|---|---|
| PubChem CID | 87392310 |
| Molecular Formula | C47H51O6P3 |
| Molecular Weight | 804.84 g/mol |
| Exact Mass | 804.29 |
| IUPAC Name | [2-[bis(4-methoxyphenyl)-phosphanylmethyl]-1,1,3,3-tetrakis(4-methoxyphenyl)-2-methyl-3-phosphanylpropyl]phosphane |
| SMILES | COc1ccc(C(P)(c2ccc(OC)cc2)C(C)(C(P)(c2ccc(OC)cc2)c2ccc(OC)cc2)C(P)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C47H51O6P3/c1-44(45(54,32-8-20-38(48-2)21-9-32)33-10-22-39(49-3)23-11-33,46(55,34-12-24-40(50-4)25-13-34)35-14-26-41(51-5)27-15-35)47(56,36-16-28-42(52-6)29-17-36)37-18-30-43(53-7)31-19-37/h8-31H,54-56H2,1-7H3 |
| InChIKey | QATVFFNWOUQYPQ-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.84 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|