C18H22N4O3 — CID 87392810
N-[2-[4-(hydroxycarbamoyl)phenyl]ethyl]-2-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 87392810) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[2-[4-(hydroxycarbamoyl)phenyl]ethyl]-2-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N-[2-[4-(hydroxycarbamoyl)phenyl]ethyl]-2-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 87392810 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[2-[4-(hydroxycarbamoyl)phenyl]ethyl]-2-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | Cn1nc2c(c1C(=O)NCCc1ccc(C(=O)NO)cc1)CCCC2 |
| InChI | InChI=1S/C18H22N4O3/c1-22-16(14-4-2-3-5-15(14)20-22)18(24)19-11-10-12-6-8-13(9-7-12)17(23)21-25/h6-9,25H,2-5,10-11H2,1H3,(H,19,24)(H,21,23) |
| InChIKey | OCVDKZOEHQQEAH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|