C22H23N5O5S — CID 87393430
ethyl [4-(2-methyl-3-phenylmethoxyanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]oxymethanesulfonate (PubChem CID 87393430) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is ethyl [4-(2-methyl-3-phenylmethoxyanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]oxymethanesulfonate.
| Compound Name | ethyl [4-(2-methyl-3-phenylmethoxyanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]oxymethanesulfonate |
|---|---|
| PubChem CID | 87393430 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | ethyl [4-(2-methyl-3-phenylmethoxyanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]oxymethanesulfonate |
| SMILES | CCOS(=O)(=O)COc1n[nH]c2ncnc(Nc3cccc(OCc4ccccc4)c3C)c12 |
| InChI | InChI=1S/C22H23N5O5S/c1-3-32-33(28,29)14-31-22-19-20(23-13-24-21(19)26-27-22)25-17-10-7-11-18(15(17)2)30-12-16-8-5-4-6-9-16/h4-11,13H,3,12,14H2,1-2H3,(H2,23,24,25,26,27) |
| InChIKey | GUOWJQPTVSPBDR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|