C22H22FN5O6S — CID 11555176
2-[[4-[4-[(3-fluorophenyl)methoxy]-3-methoxyanilino]-1H-pyrazolo[5,4-d]pyrimidin-3-yl]oxy]ethyl methanesulfonate (PubChem CID 11555176) has the molecular formula C22H22FN5O6S and a molecular weight of 503.51 g/mol. Its IUPAC name is 2-[[4-[4-[(3-fluorophenyl)methoxy]-3-methoxyanilino]-1H-pyrazolo[5,4-d]pyrimidin-3-yl]oxy]ethyl methanesulfonate.
| Compound Name | 2-[[4-[4-[(3-fluorophenyl)methoxy]-3-methoxyanilino]-1H-pyrazolo[5,4-d]pyrimidin-3-yl]oxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 11555176 |
| Molecular Formula | C22H22FN5O6S |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 2-[[4-[4-[(3-fluorophenyl)methoxy]-3-methoxyanilino]-1H-pyrazolo[5,4-d]pyrimidin-3-yl]oxy]ethyl methanesulfonate |
| SMILES | COc1cc(Nc2ncnc3[nH]nc(OCCOS(C)(=O)=O)c23)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C22H22FN5O6S/c1-31-18-11-16(6-7-17(18)33-12-14-4-3-5-15(23)10-14)26-20-19-21(25-13-24-20)27-28-22(19)32-8-9-34-35(2,29)30/h3-7,10-11,13H,8-9,12H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | UZLMATJGCNFKIK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 137.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|