C15H17FN4OS — CID 8739449
(2S)-N-(3-fluoro-4-methylphenyl)-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 8739449) has the molecular formula C15H17FN4OS and a molecular weight of 320.39 g/mol. Its IUPAC name is (2S)-N-(3-fluoro-4-methylphenyl)-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-(3-fluoro-4-methylphenyl)-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 8739449 |
| Molecular Formula | C15H17FN4OS |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (2S)-N-(3-fluoro-4-methylphenyl)-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1cnnc1S[C@@H](C)C(=O)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C15H17FN4OS/c1-4-7-20-9-17-19-15(20)22-11(3)14(21)18-12-6-5-10(2)13(16)8-12/h4-6,8-9,11H,1,7H2,2-3H3,(H,18,21)/t11-/m0/s1 |
| InChIKey | JZWBELHURHHRNC-NSHDSACASA-N |
| XLogP | 3.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|