C15H16F2N4OS2 — CID 8739414
(2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 8739414) has the molecular formula C15H16F2N4OS2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 8739414 |
| Molecular Formula | C15H16F2N4OS2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1cnnc1S[C@@H](C)C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H16F2N4OS2/c1-3-8-21-9-18-20-15(21)23-10(2)13(22)19-11-4-6-12(7-5-11)24-14(16)17/h3-7,9-10,14H,1,8H2,2H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | COFQMPSPWUBTHR-JTQLQIEISA-N |
| XLogP | 3.90 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|