C22H21N5O2 — CID 87395083
2-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,2,3,6-tetrahydropyridin-6-yl]acetaldehyde (PubChem CID 87395083) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,2,3,6-tetrahydropyridin-6-yl]acetaldehyde.
| Compound Name | 2-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,2,3,6-tetrahydropyridin-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 87395083 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,2,3,6-tetrahydropyridin-6-yl]acetaldehyde |
| SMILES | O=CCC1C=C(c2nccnc2Oc2ccc(Nc3ccccn3)cc2)CCN1 |
| InChI | InChI=1S/C22H21N5O2/c28-14-9-18-15-16(8-11-23-18)21-22(26-13-12-25-21)29-19-6-4-17(5-7-19)27-20-3-1-2-10-24-20/h1-7,10,12-15,18,23H,8-9,11H2,(H,24,27) |
| InChIKey | UORKJNVZCWIOCC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|