C13H18F3N3O3S — CID 87398008
[1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonic acid (PubChem CID 87398008) has the molecular formula C13H18F3N3O3S and a molecular weight of 353.37 g/mol. Its IUPAC name is [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonic acid.
| Compound Name | [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 87398008 |
| Molecular Formula | C13H18F3N3O3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonic acid |
| SMILES | O=S(=O)(O)CC1CCN(c2ncc(CCC(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C13H18F3N3O3S/c14-13(15,16)4-1-11-7-17-12(18-8-11)19-5-2-10(3-6-19)9-23(20,21)22/h7-8,10H,1-6,9H2,(H,20,21,22) |
| InChIKey | FOGWSZBJFAJXJQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|