About 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid
3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 87398101) has the molecular formula C21H16N2O3S
and a molecular weight of 376.44 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid |
| PubChem CID | 87398101 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC(c2cnc3ccccn23)=CC(OCc2ccccc2)C1=S |
| InChI | InChI=1S/C21H16N2O3S/c24-21(25)16-10-15(17-12-22-19-8-4-5-9-23(17)19)11-18(20(16)27)26-13-14-6-2-1-3-7-14/h1-12,18H,13H2,(H,24,25) |
| InChIKey | NZSIWKANTYXTCI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid (CID 87398101) is 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid is O=C(O)C1=CC(c2cnc3ccccn23)=CC(OCc2ccccc2)C1=S.
What is the InChIKey of 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is NZSIWKANTYXTCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3S/c24-21(25)16-10-15(17-12-22-19-8-4-5-9-23(17)19)11-18(20(16)27)26-13-14-6-2-1-3-7-14/h1-12,18H,13H2,(H,24,25).
What are the key properties of 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid?
3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 376.44 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-a]pyridin-3-yl-5-phenylmethoxy-6-sulfanylidenecyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 87398101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).