C12H13N3O — CID 87400186
1-(4-ethynylpyrimidin-2-yl)-4,4-dimethylpyrrolidin-2-one (PubChem CID 87400186) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-(4-ethynylpyrimidin-2-yl)-4,4-dimethylpyrrolidin-2-one.
| Compound Name | 1-(4-ethynylpyrimidin-2-yl)-4,4-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 87400186 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 1-(4-ethynylpyrimidin-2-yl)-4,4-dimethylpyrrolidin-2-one |
| SMILES | C#Cc1ccnc(N2CC(C)(C)CC2=O)n1 |
| InChI | InChI=1S/C12H13N3O/c1-4-9-5-6-13-11(14-9)15-8-12(2,3)7-10(15)16/h1,5-6H,7-8H2,2-3H3 |
| InChIKey | BHIJSPXBPMGWLP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|