C20H18N2O6S — CID 8740107
[2-(2-methylsulfonylanilino)-2-oxoethyl] (E)-2-cyano-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 8740107) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is [2-(2-methylsulfonylanilino)-2-oxoethyl] (E)-2-cyano-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-methylsulfonylanilino)-2-oxoethyl] (E)-2-cyano-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8740107 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | [2-(2-methylsulfonylanilino)-2-oxoethyl] (E)-2-cyano-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C(\C#N)C(=O)OCC(=O)Nc2ccccc2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H18N2O6S/c1-27-16-7-5-6-14(11-16)10-15(12-21)20(24)28-13-19(23)22-17-8-3-4-9-18(17)29(2,25)26/h3-11H,13H2,1-2H3,(H,22,23)/b15-10+ |
| InChIKey | YTNNZAMKPROPSQ-XNTDXEJSSA-N |
| XLogP | 2.19 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|