C16H9F7N4S — CID 87402163
5-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]sulfanyl-1-(2,5-dimethylphenyl)tetrazole (PubChem CID 87402163) has the molecular formula C16H9F7N4S and a molecular weight of 422.33 g/mol. Its IUPAC name is 5-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]sulfanyl-1-(2,5-dimethylphenyl)tetrazole.
| Compound Name | 5-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]sulfanyl-1-(2,5-dimethylphenyl)tetrazole |
|---|---|
| PubChem CID | 87402163 |
| Molecular Formula | C16H9F7N4S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 5-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]sulfanyl-1-(2,5-dimethylphenyl)tetrazole |
| SMILES | Cc1ccc(C)c(-n2nnnc2SC(F)(F)c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H9F7N4S/c1-6-3-4-7(2)8(5-6)27-15(24-25-26-27)28-16(22,23)9-10(17)12(19)14(21)13(20)11(9)18/h3-5H,1-2H3 |
| InChIKey | XSLABKNBLJGOQP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|