C36H34P2S2 — CID 87404108
[4-(2,5-dimethylthiophen-3-yl)-3-diphenylphosphanyl-2,5-dimethyl-2H-thiophen-3-yl]-diphenylphosphane (PubChem CID 87404108) has the molecular formula C36H34P2S2 and a molecular weight of 592.75 g/mol. Its IUPAC name is [4-(2,5-dimethylthiophen-3-yl)-3-diphenylphosphanyl-2,5-dimethyl-2H-thiophen-3-yl]-diphenylphosphane.
| Compound Name | [4-(2,5-dimethylthiophen-3-yl)-3-diphenylphosphanyl-2,5-dimethyl-2H-thiophen-3-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 87404108 |
| Molecular Formula | C36H34P2S2 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | [4-(2,5-dimethylthiophen-3-yl)-3-diphenylphosphanyl-2,5-dimethyl-2H-thiophen-3-yl]-diphenylphosphane |
| SMILES | CC1=C(c2cc(C)sc2C)C(P(c2ccccc2)c2ccccc2)(P(c2ccccc2)c2ccccc2)C(C)S1 |
| InChI | InChI=1S/C36H34P2S2/c1-26-25-34(27(2)39-26)35-28(3)40-29(4)36(35,37(30-17-9-5-10-18-30)31-19-11-6-12-20-31)38(32-21-13-7-14-22-32)33-23-15-8-16-24-33/h5-25,29H,1-4H3 |
| InChIKey | GTIZUPXVXLCIRA-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|