C20H44N2O — CID 87410137
1-decoxydecane-1,1-diamine (PubChem CID 87410137) has the molecular formula C20H44N2O and a molecular weight of 328.59 g/mol. Its IUPAC name is 1-decoxydecane-1,1-diamine.
| Compound Name | 1-decoxydecane-1,1-diamine |
|---|---|
| PubChem CID | 87410137 |
| Molecular Formula | C20H44N2O |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 328.35 |
| IUPAC Name | 1-decoxydecane-1,1-diamine |
| SMILES | CCCCCCCCCCOC(N)(N)CCCCCCCCC |
| InChI | InChI=1S/C20H44N2O/c1-3-5-7-9-11-13-15-17-19-23-20(21,22)18-16-14-12-10-8-6-4-2/h3-19,21-22H2,1-2H3 |
| InChIKey | GYKBGGRTIRQVBR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|