C22H38FNO5Si — CID 87411671
tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[4-(5-fluoro-2-methoxyphenyl)-4-hydroxybutyl]carbamate (PubChem CID 87411671) has the molecular formula C22H38FNO5Si and a molecular weight of 443.63 g/mol. Its IUPAC name is tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[4-(5-fluoro-2-methoxyphenyl)-4-hydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[4-(5-fluoro-2-methoxyphenyl)-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 87411671 |
| Molecular Formula | C22H38FNO5Si |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[4-(5-fluoro-2-methoxyphenyl)-4-hydroxybutyl]carbamate |
| SMILES | COc1ccc(F)cc1C(O)CCCN(O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38FNO5Si/c1-21(2,3)28-20(26)24(29-30(8,9)22(4,5)6)14-10-11-18(25)17-15-16(23)12-13-19(17)27-7/h12-13,15,18,25H,10-11,14H2,1-9H3 |
| InChIKey | HTLHHOOVPILXTK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|