C26H16N6 — CID 87412129
4-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)-6-isocyano-1,3,5-triazine-2-carbonitrile (PubChem CID 87412129) has the molecular formula C26H16N6 and a molecular weight of 412.46 g/mol. Its IUPAC name is 4-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)-6-isocyano-1,3,5-triazine-2-carbonitrile.
| Compound Name | 4-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)-6-isocyano-1,3,5-triazine-2-carbonitrile |
|---|---|
| PubChem CID | 87412129 |
| Molecular Formula | C26H16N6 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)-6-isocyano-1,3,5-triazine-2-carbonitrile |
| SMILES | [C-]#[N+]c1nc(C#N)nc(-n2c3ccccc3c3ccc4c(c32)C(C)(C)c2ccccc2-4)n1 |
| InChI | InChI=1S/C26H16N6/c1-26(2)19-10-6-4-8-15(19)17-12-13-18-16-9-5-7-11-20(16)32(23(18)22(17)26)25-30-21(14-27)29-24(28-3)31-25/h4-13H,1-2H3 |
| InChIKey | GQTWDVRWLTULPN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|