C52H44O2P2 — CID 87412642
9,19-bis(diphenylphosphoryl)-12,12,22,22-tetramethylhexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-2(11),3,5,7,9,14,16(21),17,19,23-decaene (PubChem CID 87412642) has the molecular formula C52H44O2P2 and a molecular weight of 762.87 g/mol. Its IUPAC name is 9,19-bis(diphenylphosphoryl)-12,12,22,22-tetramethylhexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-2(11),3,5,7,9,14,16(21),17,19,23-decaene.
| Compound Name | 9,19-bis(diphenylphosphoryl)-12,12,22,22-tetramethylhexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-2(11),3,5,7,9,14,16(21),17,19,23-decaene |
|---|---|
| PubChem CID | 87412642 |
| Molecular Formula | C52H44O2P2 |
| Molecular Weight | 762.87 g/mol |
| Exact Mass | 762.28 |
| IUPAC Name | 9,19-bis(diphenylphosphoryl)-12,12,22,22-tetramethylhexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-2(11),3,5,7,9,14,16(21),17,19,23-decaene |
| SMILES | CC1(C)C2=CC3c4c(cc(P(=O)(c5ccccc5)c5ccccc5)c5ccccc45)C(C)(C)C3C=C2c2ccc(P(=O)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C52H44O2P2/c1-51(2)45-31-39(55(53,35-19-9-5-10-20-35)36-21-11-6-12-22-36)29-30-40(45)43-32-47-44(33-46(43)51)50-42-28-18-17-27-41(42)49(34-48(50)52(47,3)4)56(54,37-23-13-7-14-24-37)38-25-15-8-16-26-38/h5-34,44,47H,1-4H3 |
| InChIKey | ZXAIHHLATHNIRH-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.87 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|