C18H23N3O2 — CID 8741284
(3S)-N-(3-acetylphenyl)-3-(3,4,5-trimethylpyrazol-1-yl)butanamide (PubChem CID 8741284) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (3S)-N-(3-acetylphenyl)-3-(3,4,5-trimethylpyrazol-1-yl)butanamide.
| Compound Name | (3S)-N-(3-acetylphenyl)-3-(3,4,5-trimethylpyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 8741284 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (3S)-N-(3-acetylphenyl)-3-(3,4,5-trimethylpyrazol-1-yl)butanamide |
| SMILES | CC(=O)c1cccc(NC(=O)C[C@H](C)n2nc(C)c(C)c2C)c1 |
| InChI | InChI=1S/C18H23N3O2/c1-11(21-14(4)12(2)13(3)20-21)9-18(23)19-17-8-6-7-16(10-17)15(5)22/h6-8,10-11H,9H2,1-5H3,(H,19,23)/t11-/m0/s1 |
| InChIKey | MZFJWRDKUQRLIN-NSHDSACASA-N |
| XLogP | 3.60 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |