C24H22ClN5OS — CID 87413906
N-(4-chloro-3-pyridin-2-ylphenyl)-4-(3-imidazol-1-ylpropylamino)sulfanylbenzamide (PubChem CID 87413906) has the molecular formula C24H22ClN5OS and a molecular weight of 463.99 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-4-(3-imidazol-1-ylpropylamino)sulfanylbenzamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-(3-imidazol-1-ylpropylamino)sulfanylbenzamide |
|---|---|
| PubChem CID | 87413906 |
| Molecular Formula | C24H22ClN5OS |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-(3-imidazol-1-ylpropylamino)sulfanylbenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ccccn2)c1)c1ccc(SNCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C24H22ClN5OS/c25-22-10-7-19(16-21(22)23-4-1-2-11-27-23)29-24(31)18-5-8-20(9-6-18)32-28-12-3-14-30-15-13-26-17-30/h1-2,4-11,13,15-17,28H,3,12,14H2,(H,29,31) |
| InChIKey | KTCIMRIVLRVAGH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|