C10H26N4O — CID 87415655
1-(1,1-diamino-2,2-dimethylpropoxy)-2,2-dimethylpropane-1,1-diamine (PubChem CID 87415655) has the molecular formula C10H26N4O and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-(1,1-diamino-2,2-dimethylpropoxy)-2,2-dimethylpropane-1,1-diamine.
| Compound Name | 1-(1,1-diamino-2,2-dimethylpropoxy)-2,2-dimethylpropane-1,1-diamine |
|---|---|
| PubChem CID | 87415655 |
| Molecular Formula | C10H26N4O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.21 |
| IUPAC Name | 1-(1,1-diamino-2,2-dimethylpropoxy)-2,2-dimethylpropane-1,1-diamine |
| SMILES | CC(C)(C)C(N)(N)OC(N)(N)C(C)(C)C |
| InChI | InChI=1S/C10H26N4O/c1-7(2,3)9(11,12)15-10(13,14)8(4,5)6/h11-14H2,1-6H3 |
| InChIKey | IJPSLSHLZVYMPZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|