C8H22N4O — CID 87415803
1-(1,1-diamino-2-methylpropoxy)-2-methylpropane-1,1-diamine (PubChem CID 87415803) has the molecular formula C8H22N4O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-(1,1-diamino-2-methylpropoxy)-2-methylpropane-1,1-diamine.
| Compound Name | 1-(1,1-diamino-2-methylpropoxy)-2-methylpropane-1,1-diamine |
|---|---|
| PubChem CID | 87415803 |
| Molecular Formula | C8H22N4O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.18 |
| IUPAC Name | 1-(1,1-diamino-2-methylpropoxy)-2-methylpropane-1,1-diamine |
| SMILES | CC(C)C(N)(N)OC(N)(N)C(C)C |
| InChI | InChI=1S/C8H22N4O/c1-5(2)7(9,10)13-8(11,12)6(3)4/h5-6H,9-12H2,1-4H3 |
| InChIKey | UEAMJRDEPNKHTQ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|