C20H18FNO4 — CID 87415672
trans-(1R,2R)-2-[4-(3-fluoro-4-formamidophenyl)benzoyl]cyclopentane-1-carboxylic acid (PubChem CID 87415672) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is trans-(1R,2R)-2-[4-(3-fluoro-4-formamidophenyl)benzoyl]cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[4-(3-fluoro-4-formamidophenyl)benzoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 87415672 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | trans-(1R,2R)-2-[4-(3-fluoro-4-formamidophenyl)benzoyl]cyclopentane-1-carboxylic acid |
| SMILES | O=CNc1ccc(-c2ccc(C(=O)[C@@H]3CCC[C@H]3C(=O)O)cc2)cc1F |
| InChI | InChI=1S/C20H18FNO4/c21-17-10-14(8-9-18(17)22-11-23)12-4-6-13(7-5-12)19(24)15-2-1-3-16(15)20(25)26/h4-11,15-16H,1-3H2,(H,22,23)(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | AIWUGOFWNDQVJO-HZPDHXFCSA-N |
| XLogP | 3.74 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|