C11H17O4S- — CID 8741597
(R)-1-adamantyl(hydroxy)methanesulfonate (PubChem CID 8741597) has the molecular formula C11H17O4S- and a molecular weight of 245.32 g/mol. Its IUPAC name is (R)-1-adamantyl(hydroxy)methanesulfonate.
| Compound Name | (R)-1-adamantyl(hydroxy)methanesulfonate |
|---|---|
| PubChem CID | 8741597 |
| Molecular Formula | C11H17O4S- |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (R)-1-adamantyl(hydroxy)methanesulfonate |
| SMILES | O=S(=O)([O-])[C@@H](O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H18O4S/c12-10(16(13,14)15)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-10,12H,1-6H2,(H,13,14,15)/p-1/t7?,8?,9?,10-,11?/m1/s1 |
| InChIKey | JNJCHNDSTMRCLP-IYGUQASQSA-M |
| XLogP | 1.07 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|