C14H26NO+ — CID 7154824
[(1S,2S)-1-(1-adamantyl)-1-hydroxypropan-2-yl]-methylazanium (PubChem CID 7154824) has the molecular formula C14H26NO+ and a molecular weight of 224.37 g/mol. Its IUPAC name is [(1S,2S)-1-(1-adamantyl)-1-hydroxypropan-2-yl]-methylazanium.
| Compound Name | [(1S,2S)-1-(1-adamantyl)-1-hydroxypropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 7154824 |
| Molecular Formula | C14H26NO+ |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | [(1S,2S)-1-(1-adamantyl)-1-hydroxypropan-2-yl]-methylazanium |
| SMILES | C[NH2+][C@@H](C)[C@@H](O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H25NO/c1-9(15-2)13(16)14-6-10-3-11(7-14)5-12(4-10)8-14/h9-13,15-16H,3-8H2,1-2H3/p+1/t9-,10?,11?,12?,13+,14?/m0/s1 |
| InChIKey | QOJWHENDBLGQRS-OIYBMSTKSA-O |
| XLogP | 1.15 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |