C14H24NO+ — CID 7064893
[(2S)-1-(1-adamantyl)-1-oxopropan-2-yl]-methylazanium (PubChem CID 7064893) has the molecular formula C14H24NO+ and a molecular weight of 222.35 g/mol. Its IUPAC name is [(2S)-1-(1-adamantyl)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | [(2S)-1-(1-adamantyl)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 7064893 |
| Molecular Formula | C14H24NO+ |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | [(2S)-1-(1-adamantyl)-1-oxopropan-2-yl]-methylazanium |
| SMILES | C[NH2+][C@@H](C)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H23NO/c1-9(15-2)13(16)14-6-10-3-11(7-14)5-12(4-10)8-14/h9-12,15H,3-8H2,1-2H3/p+1/t9-,10?,11?,12?,14?/m0/s1 |
| InChIKey | WSZNXOWXMNCLMF-BRZBPJHZSA-O |
| XLogP | 1.35 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |