C16H28NO+ — CID 7470790
[(2R)-1-(1-adamantyl)-1-oxopropan-2-yl]-propan-2-ylazanium (PubChem CID 7470790) has the molecular formula C16H28NO+ and a molecular weight of 250.41 g/mol. Its IUPAC name is [(2R)-1-(1-adamantyl)-1-oxopropan-2-yl]-propan-2-ylazanium.
| Compound Name | [(2R)-1-(1-adamantyl)-1-oxopropan-2-yl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 7470790 |
| Molecular Formula | C16H28NO+ |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | [(2R)-1-(1-adamantyl)-1-oxopropan-2-yl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+][C@H](C)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H27NO/c1-10(2)17-11(3)15(18)16-7-12-4-13(8-16)6-14(5-12)9-16/h10-14,17H,4-9H2,1-3H3/p+1/t11-,12?,13?,14?,16?/m1/s1 |
| InChIKey | ITAAOLAOFMHPDF-UWJCENJNSA-O |
| XLogP | 2.13 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |