About 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane
1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane (PubChem CID 159977923) has the molecular formula C21H36
and a molecular weight of 288.52 g/mol. Its IUPAC name is 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane.
Molecular Properties
| Compound Name | 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane |
| PubChem CID | 159977923 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane |
| SMILES | CC(C)C12CC(C1)C2.CC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H22.C8H14/c1-9(2)13-6-10-3-11(7-13)5-12(4-10)8-13;1-6(2)8-3-7(4-8)5-8/h9-12H,3-8H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | OFJVFXHPWYXOIR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane?
The IUPAC name of 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane (CID 159977923) is 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane.
What is the SMILES notation for 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane?
The canonical SMILES for 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane is CC(C)C12CC(C1)C2.CC(C)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane?
The InChIKey is OFJVFXHPWYXOIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22.C8H14/c1-9(2)13-6-10-3-11(7-13)5-12(4-10)8-13;1-6(2)8-3-7(4-8)5-8/h9-12H,3-8H2,1-2H3;6-7H,3-5H2,1-2H3.
What are the key properties of 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane?
1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane has a molecular weight of 288.52 g/mol, XLogP of 6.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yladamantane;1-propan-2-ylbicyclo[1.1.1]pentane is sourced from PubChem (CID 159977923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).