About ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane)
ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane) (PubChem CID 160629751) has the molecular formula C45H84
and a molecular weight of 625.17 g/mol. Its IUPAC name is ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane).
Molecular Properties
| Compound Name | ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane) |
| PubChem CID | 160629751 |
| Molecular Formula | C45H84 |
| Molecular Weight | 625.17 g/mol |
| Exact Mass | 624.66 |
| IUPAC Name | ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane) |
| SMILES | CC.CC.CC.CC(C)C12CC3CC(CC(C3)C1)C2.CC(C)C1C2CC3CC(C2)CC1C3.CC(C)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/3C13H22.3C2H6/c1-9(2)13-6-10-3-11(7-13)5-12(4-10)8-13;2*1-8(2)13-11-4-9-3-10(6-11)7-12(13)5-9;3*1-2/h9-12H,3-8H2,1-2H3;2*8-13H,3-7H2,1-2H3;3*1-2H3 |
| InChIKey | RHTPMNLTRQFQMA-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 625.17 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane)?
The IUPAC name of ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane) (CID 160629751) is ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane).
What is the SMILES notation for ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane)?
The canonical SMILES for ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane) is CC.CC.CC.CC(C)C12CC3CC(CC(C3)C1)C2.CC(C)C1C2CC3CC(C2)CC1C3.CC(C)C1C2CC3CC(C2)CC1C3.
What is the InChIKey of ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane)?
The InChIKey is RHTPMNLTRQFQMA-UHFFFAOYSA-N. The full InChI is InChI=1S/3C13H22.3C2H6/c1-9(2)13-6-10-3-11(7-13)5-12(4-10)8-13;2*1-8(2)13-11-4-9-3-10(6-11)7-12(13)5-9;3*1-2/h9-12H,3-8H2,1-2H3;2*8-13H,3-7H2,1-2H3;3*1-2H3.
What are the key properties of ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane)?
ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane) has a molecular weight of 625.17 g/mol, XLogP of 14.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-propan-2-yladamantane;bis(2-propan-2-yladamantane) is sourced from PubChem (CID 160629751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).