About 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide
1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide (PubChem CID 87417797) has the molecular formula C28H24N4OS
and a molecular weight of 464.59 g/mol. Its IUPAC name is 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide.
Molecular Properties
| Compound Name | 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide |
| PubChem CID | 87417797 |
| Molecular Formula | C28H24N4OS |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide |
| SMILES | CC(c1ccccc1)n1cc(C(=O)Nc2nccs2)c2ccccc21.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C20H17N3OS.C8H7N/c1-14(15-7-3-2-4-8-15)23-13-17(16-9-5-6-10-18(16)23)19(24)22-20-21-11-12-25-20;1-2-4-8-7(3-1)5-6-9-8/h2-14H,1H3,(H,21,22,24);1-6,9H |
| InChIKey | ZTHGRRKMKDHRMV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide?
The IUPAC name of 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide (CID 87417797) is 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide.
What is the SMILES notation for 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide?
The canonical SMILES for 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide is CC(c1ccccc1)n1cc(C(=O)Nc2nccs2)c2ccccc21.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide?
The InChIKey is ZTHGRRKMKDHRMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3OS.C8H7N/c1-14(15-7-3-2-4-8-15)23-13-17(16-9-5-6-10-18(16)23)19(24)22-20-21-11-12-25-20;1-2-4-8-7(3-1)5-6-9-8/h2-14H,1H3,(H,21,22,24);1-6,9H.
What are the key properties of 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide?
1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide has a molecular weight of 464.59 g/mol, XLogP of 7.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)indole-3-carboxamide is sourced from PubChem (CID 87417797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).