C16H17N5S — CID 87418948
(5-propyl-7-pyridin-3-yl-1H-indazol-3-yl)thiourea (PubChem CID 87418948) has the molecular formula C16H17N5S and a molecular weight of 311.41 g/mol. Its IUPAC name is (5-propyl-7-pyridin-3-yl-1H-indazol-3-yl)thiourea.
| Compound Name | (5-propyl-7-pyridin-3-yl-1H-indazol-3-yl)thiourea |
|---|---|
| PubChem CID | 87418948 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (5-propyl-7-pyridin-3-yl-1H-indazol-3-yl)thiourea |
| SMILES | CCCc1cc(-c2cccnc2)c2[nH]nc(NC(N)=S)c2c1 |
| InChI | InChI=1S/C16H17N5S/c1-2-4-10-7-12(11-5-3-6-18-9-11)14-13(8-10)15(21-20-14)19-16(17)22/h3,5-9H,2,4H2,1H3,(H4,17,19,20,21,22) |
| InChIKey | XQLLKIKMQVVFKD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|