C13H10ClN5S — CID 86660015
[5-(3-chloro-2-pyridinyl)-1H-indazol-3-yl]thiourea (PubChem CID 86660015) has the molecular formula C13H10ClN5S and a molecular weight of 303.78 g/mol. Its IUPAC name is [5-(3-chloro-2-pyridinyl)-1H-indazol-3-yl]thiourea.
| Compound Name | [5-(3-chloro-2-pyridinyl)-1H-indazol-3-yl]thiourea |
|---|---|
| PubChem CID | 86660015 |
| Molecular Formula | C13H10ClN5S |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | [5-(3-chloro-2-pyridinyl)-1H-indazol-3-yl]thiourea |
| SMILES | NC(=S)Nc1n[nH]c2ccc(-c3ncccc3Cl)cc12 |
| InChI | InChI=1S/C13H10ClN5S/c14-9-2-1-5-16-11(9)7-3-4-10-8(6-7)12(19-18-10)17-13(15)20/h1-6H,(H4,15,17,18,19,20) |
| InChIKey | YJZIDWAOFLNIIZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|