C17H17N5S — CID 67490004
5-(3-amino-2-pyridinyl)-N-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-1H-indazol-3-amine (PubChem CID 67490004) has the molecular formula C17H17N5S and a molecular weight of 323.43 g/mol. Its IUPAC name is 5-(3-amino-2-pyridinyl)-N-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-1H-indazol-3-amine.
| Compound Name | 5-(3-amino-2-pyridinyl)-N-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 67490004 |
| Molecular Formula | C17H17N5S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 5-(3-amino-2-pyridinyl)-N-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-1H-indazol-3-amine |
| SMILES | C=C(Nc1n[nH]c2ccc(-c3ncccc3N)cc12)S/C=C\C |
| InChI | InChI=1S/C17H17N5S/c1-3-9-23-11(2)20-17-13-10-12(6-7-15(13)21-22-17)16-14(18)5-4-8-19-16/h3-10H,2,18H2,1H3,(H2,20,21,22)/b9-3- |
| InChIKey | SHIMDPKZEMYBQT-OQFOIZHKSA-N |
| XLogP | 4.36 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |