C16H16N4OS2 — CID 8742011
1-ethyl-3-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)thiourea (PubChem CID 8742011) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is 1-ethyl-3-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)thiourea.
| Compound Name | 1-ethyl-3-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)thiourea |
|---|---|
| PubChem CID | 8742011 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-ethyl-3-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)thiourea |
| SMILES | CCNC(=S)Nn1cnc2sc(C)c(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C16H16N4OS2/c1-3-17-16(22)19-20-9-18-14-13(15(20)21)12(10(2)23-14)11-7-5-4-6-8-11/h4-9H,3H2,1-2H3,(H2,17,19,22) |
| InChIKey | GYTBXEDNQSHRCR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|