C21H24N4OS2 — CID 8742078
1-[(1S,2S)-2-methylcyclohexyl]-3-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)thiourea (PubChem CID 8742078) has the molecular formula C21H24N4OS2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methylcyclohexyl]-3-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)thiourea.
| Compound Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)thiourea |
|---|---|
| PubChem CID | 8742078 |
| Molecular Formula | C21H24N4OS2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)thiourea |
| SMILES | Cc1sc2ncn(NC(=S)N[C@H]3CCCC[C@@H]3C)c(=O)c2c1-c1ccccc1 |
| InChI | InChI=1S/C21H24N4OS2/c1-13-8-6-7-11-16(13)23-21(27)24-25-12-22-19-18(20(25)26)17(14(2)28-19)15-9-4-3-5-10-15/h3-5,9-10,12-13,16H,6-8,11H2,1-2H3,(H2,23,24,27)/t13-,16-/m0/s1 |
| InChIKey | SAAVVLXRSJRIKB-BBRMVZONSA-N |
| XLogP | 4.43 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|