C20H23BFN3O3S2 — CID 87420192
CID 87420192 (PubChem CID 87420192) has the molecular formula C20H23BFN3O3S2 and a molecular weight of 447.37 g/mol.
| Compound Name | CID 87420192 |
|---|---|
| PubChem CID | 87420192 |
| Molecular Formula | C20H23BFN3O3S2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(CC2CCCC2)C(=O)Nc2ncc(SC(C)(C)C(=O)O)s2)c(F)c1 |
| InChI | InChI=1S/C20H23BFN3O3S2/c1-20(2,17(26)27)30-16-10-23-18(29-16)24-19(28)25(11-12-5-3-4-6-12)15-8-7-13(21)9-14(15)22/h7-10,12H,3-6,11H2,1-2H3,(H,26,27)(H,23,24,28) |
| InChIKey | MACPPVYJMSBDID-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|