C19H23ClFN3O3S2 — CID 143719856
1-(4-chloro-2-fluorophenyl)-1-(cyclopentylmethyl)-3-(5-ethylsulfanyl-1,3-thiazol-2-yl)urea;formic acid (PubChem CID 143719856) has the molecular formula C19H23ClFN3O3S2 and a molecular weight of 460.00 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-1-(cyclopentylmethyl)-3-(5-ethylsulfanyl-1,3-thiazol-2-yl)urea;formic acid.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-1-(cyclopentylmethyl)-3-(5-ethylsulfanyl-1,3-thiazol-2-yl)urea;formic acid |
|---|---|
| PubChem CID | 143719856 |
| Molecular Formula | C19H23ClFN3O3S2 |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-1-(cyclopentylmethyl)-3-(5-ethylsulfanyl-1,3-thiazol-2-yl)urea;formic acid |
| SMILES | CCSc1cnc(NC(=O)N(CC2CCCC2)c2ccc(Cl)cc2F)s1.O=CO |
| InChI | InChI=1S/C18H21ClFN3OS2.CH2O2/c1-2-25-16-10-21-17(26-16)22-18(24)23(11-12-5-3-4-6-12)15-8-7-13(19)9-14(15)20;2-1-3/h7-10,12H,2-6,11H2,1H3,(H,21,22,24);1H,(H,2,3) |
| InChIKey | KWJDTHQYCOZRNQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|